C7H13N3O4S2 — CID 104621010
N-(4-ethyl-1H-pyrazol-5-yl)-1-methylsulfonylmethanesulfonamide (PubChem CID 104621010) has the molecular formula C7H13N3O4S2 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-(4-ethyl-1H-pyrazol-5-yl)-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-(4-ethyl-1H-pyrazol-5-yl)-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 104621010 |
| Molecular Formula | C7H13N3O4S2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | N-(4-ethyl-1H-pyrazol-5-yl)-1-methylsulfonylmethanesulfonamide |
| SMILES | CCc1cn[nH]c1NS(=O)(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C7H13N3O4S2/c1-3-6-4-8-9-7(6)10-16(13,14)5-15(2,11)12/h4H,3,5H2,1-2H3,(H2,8,9,10) |
| InChIKey | DRPXZBBHEHNVSA-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |