C13H16N2O2 — CID 55151977
2-[(2,4-dihydroxyphenyl)methylamino]cyclopentane-1-carbonitrile (PubChem CID 55151977) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-[(2,4-dihydroxyphenyl)methylamino]cyclopentane-1-carbonitrile.
| Compound Name | 2-[(2,4-dihydroxyphenyl)methylamino]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 55151977 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-[(2,4-dihydroxyphenyl)methylamino]cyclopentane-1-carbonitrile |
| SMILES | N#CC1CCCC1NCc1ccc(O)cc1O |
| InChI | InChI=1S/C13H16N2O2/c14-7-9-2-1-3-12(9)15-8-10-4-5-11(16)6-13(10)17/h4-6,9,12,15-17H,1-3,8H2 |
| InChIKey | FBSDHBAGFXPUFI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|