C14H18N2O2 — CID 62963106
2-[1-(2,5-dihydroxyphenyl)ethylamino]cyclopentane-1-carbonitrile (PubChem CID 62963106) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[1-(2,5-dihydroxyphenyl)ethylamino]cyclopentane-1-carbonitrile.
| Compound Name | 2-[1-(2,5-dihydroxyphenyl)ethylamino]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 62963106 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-[1-(2,5-dihydroxyphenyl)ethylamino]cyclopentane-1-carbonitrile |
| SMILES | CC(NC1CCCC1C#N)c1cc(O)ccc1O |
| InChI | InChI=1S/C14H18N2O2/c1-9(12-7-11(17)5-6-14(12)18)16-13-4-2-3-10(13)8-15/h5-7,9-10,13,16-18H,2-4H2,1H3 |
| InChIKey | LGWNVCSUNHEOOU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|