C14H22N2O2 — CID 55152176
4-methyl-1-[2-[1-(oxolan-2-yl)ethylamino]ethyl]pyridin-2-one (PubChem CID 55152176) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-methyl-1-[2-[1-(oxolan-2-yl)ethylamino]ethyl]pyridin-2-one.
| Compound Name | 4-methyl-1-[2-[1-(oxolan-2-yl)ethylamino]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 55152176 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 4-methyl-1-[2-[1-(oxolan-2-yl)ethylamino]ethyl]pyridin-2-one |
| SMILES | Cc1ccn(CCNC(C)C2CCCO2)c(=O)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-11-5-7-16(14(17)10-11)8-6-15-12(2)13-4-3-9-18-13/h5,7,10,12-13,15H,3-4,6,8-9H2,1-2H3 |
| InChIKey | UQPWWXVUXHXZML-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |