C16H20Cl2N2O — CID 103428056
N-[2-(4,6-dichloroindol-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine (PubChem CID 103428056) has the molecular formula C16H20Cl2N2O and a molecular weight of 327.25 g/mol. Its IUPAC name is N-[2-(4,6-dichloroindol-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine.
| Compound Name | N-[2-(4,6-dichloroindol-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 103428056 |
| Molecular Formula | C16H20Cl2N2O |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[2-(4,6-dichloroindol-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine |
| SMILES | CC(NCCn1ccc2c(Cl)cc(Cl)cc21)C1CCCO1 |
| InChI | InChI=1S/C16H20Cl2N2O/c1-11(16-3-2-8-21-16)19-5-7-20-6-4-13-14(18)9-12(17)10-15(13)20/h4,6,9-11,16,19H,2-3,5,7-8H2,1H3 |
| InChIKey | IBTJYNNVINOAIK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |