About 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide
4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide (PubChem CID 55156475) has the molecular formula C12H19N5
and a molecular weight of 233.32 g/mol. Its IUPAC name is 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide.
Molecular Properties
| Compound Name | 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide |
| PubChem CID | 55156475 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(N2CCCN(C)CC2)ccn1 |
| InChI | InChI=1S/C12H19N5/c1-16-5-2-6-17(8-7-16)10-3-4-15-11(9-10)12(13)14/h3-4,9H,2,5-8H2,1H3,(H3,13,14) |
| InChIKey | AKBNKEOITRQFPH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 69.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide?
The IUPAC name of 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide (CID 55156475) is 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide.
What is the SMILES notation for 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide?
The canonical SMILES for 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide is [H]/N=C(\N)c1cc(N2CCCN(C)CC2)ccn1.
What is the InChIKey of 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide?
The InChIKey is AKBNKEOITRQFPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N5/c1-16-5-2-6-17(8-7-16)10-3-4-15-11(9-10)12(13)14/h3-4,9H,2,5-8H2,1H3,(H3,13,14).
What are the key properties of 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide?
4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide has a molecular weight of 233.32 g/mol, XLogP of 0.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide is sourced from PubChem (CID 55156475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).