C12H19N5 — CID 55156475
4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide (PubChem CID 55156475) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide.
| Compound Name | 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 55156475 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 4-(4-methyl-1,4-diazepan-1-yl)pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(N2CCCN(C)CC2)ccn1 |
| InChI | InChI=1S/C12H19N5/c1-16-5-2-6-17(8-7-16)10-3-4-15-11(9-10)12(13)14/h3-4,9H,2,5-8H2,1H3,(H3,13,14) |
| InChIKey | AKBNKEOITRQFPH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 69.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|