C11H19N5O3 — CID 55157025
3-[bis(2-amino-2-oxoethyl)amino]-N-(2-cyanoethyl)-N-methylpropanamide (PubChem CID 55157025) has the molecular formula C11H19N5O3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-[bis(2-amino-2-oxoethyl)amino]-N-(2-cyanoethyl)-N-methylpropanamide.
| Compound Name | 3-[bis(2-amino-2-oxoethyl)amino]-N-(2-cyanoethyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 55157025 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 3-[bis(2-amino-2-oxoethyl)amino]-N-(2-cyanoethyl)-N-methylpropanamide |
| SMILES | CN(CCC#N)C(=O)CCN(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C11H19N5O3/c1-15(5-2-4-12)11(19)3-6-16(7-9(13)17)8-10(14)18/h2-3,5-8H2,1H3,(H2,13,17)(H2,14,18) |
| InChIKey | NWLZNCJUTLRHJU-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |