C13H21NO3 — CID 55157304
5-[bis(prop-2-enyl)amino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 55157304) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 5-[bis(prop-2-enyl)amino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[bis(prop-2-enyl)amino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 55157304 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 5-[bis(prop-2-enyl)amino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | C=CCN(CC=C)C(=O)CC(C)(C)CC(=O)O |
| InChI | InChI=1S/C13H21NO3/c1-5-7-14(8-6-2)11(15)9-13(3,4)10-12(16)17/h5-6H,1-2,7-10H2,3-4H3,(H,16,17) |
| InChIKey | LICRAEDIAUSQBU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|