C15H20N2O — CID 55158622
N'-(2,3-dihydro-1-benzofuran-2-ylmethyl)cyclopentanecarboximidamide (PubChem CID 55158622) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N'-(2,3-dihydro-1-benzofuran-2-ylmethyl)cyclopentanecarboximidamide.
| Compound Name | N'-(2,3-dihydro-1-benzofuran-2-ylmethyl)cyclopentanecarboximidamide |
|---|---|
| PubChem CID | 55158622 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N'-(2,3-dihydro-1-benzofuran-2-ylmethyl)cyclopentanecarboximidamide |
| SMILES | N/C(=N\CC1Cc2ccccc2O1)C1CCCC1 |
| InChI | InChI=1S/C15H20N2O/c16-15(11-5-1-2-6-11)17-10-13-9-12-7-3-4-8-14(12)18-13/h3-4,7-8,11,13H,1-2,5-6,9-10H2,(H2,16,17) |
| InChIKey | ZRDDPAPWIWCRAO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|