C14H20N2O — CID 55159660
4-piperidin-4-yl-3,5-dihydro-2H-1,4-benzoxazepine (PubChem CID 55159660) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 4-piperidin-4-yl-3,5-dihydro-2H-1,4-benzoxazepine.
| Compound Name | 4-piperidin-4-yl-3,5-dihydro-2H-1,4-benzoxazepine |
|---|---|
| PubChem CID | 55159660 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 4-piperidin-4-yl-3,5-dihydro-2H-1,4-benzoxazepine |
| SMILES | c1ccc2c(c1)CN(C1CCNCC1)CCO2 |
| InChI | InChI=1S/C14H20N2O/c1-2-4-14-12(3-1)11-16(9-10-17-14)13-5-7-15-8-6-13/h1-4,13,15H,5-11H2 |
| InChIKey | MAEFNDKSFLCCQM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |