About 4,5-dihydro-1,4-benzoxazepin-3-one
4,5-dihydro-1,4-benzoxazepin-3-one (PubChem CID 919801) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 4,5-dihydro-1,4-benzoxazepin-3-one.
Molecular Properties
| Compound Name | 4,5-dihydro-1,4-benzoxazepin-3-one |
| PubChem CID | 919801 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 4,5-dihydro-1,4-benzoxazepin-3-one |
| SMILES | O=C1COc2ccccc2CN1 |
| InChI | InChI=1S/C9H9NO2/c11-9-6-12-8-4-2-1-3-7(8)5-10-9/h1-4H,5-6H2,(H,10,11) |
| InChIKey | LBZDEGAIDVFUHM-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dihydro-1,4-benzoxazepin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1,4-benzoxazepin-3-one?
The IUPAC name of 4,5-dihydro-1,4-benzoxazepin-3-one (CID 919801) is 4,5-dihydro-1,4-benzoxazepin-3-one.
What is the SMILES notation for 4,5-dihydro-1,4-benzoxazepin-3-one?
The canonical SMILES for 4,5-dihydro-1,4-benzoxazepin-3-one is O=C1COc2ccccc2CN1.
What is the InChIKey of 4,5-dihydro-1,4-benzoxazepin-3-one?
The InChIKey is LBZDEGAIDVFUHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c11-9-6-12-8-4-2-1-3-7(8)5-10-9/h1-4H,5-6H2,(H,10,11).
What are the key properties of 4,5-dihydro-1,4-benzoxazepin-3-one?
4,5-dihydro-1,4-benzoxazepin-3-one has a molecular weight of 163.18 g/mol, XLogP of 0.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1,4-benzoxazepin-3-one is sourced from PubChem (CID 919801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).