C13H16F2N2O2 — CID 55160007
3,5-difluoro-4-(methylamino)-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 55160007) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 3,5-difluoro-4-(methylamino)-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3,5-difluoro-4-(methylamino)-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55160007 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3,5-difluoro-4-(methylamino)-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CNc1c(F)cc(C(=O)NCC2CCCO2)cc1F |
| InChI | InChI=1S/C13H16F2N2O2/c1-16-12-10(14)5-8(6-11(12)15)13(18)17-7-9-3-2-4-19-9/h5-6,9,16H,2-4,7H2,1H3,(H,17,18) |
| InChIKey | IQESODRXTKPYEG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |