C14H31NO2S — CID 55161198
2-methyl-N-(2-methylpropyl)-5-methylsulfonyl-2-propylpentan-1-amine (PubChem CID 55161198) has the molecular formula C14H31NO2S and a molecular weight of 277.47 g/mol. Its IUPAC name is 2-methyl-N-(2-methylpropyl)-5-methylsulfonyl-2-propylpentan-1-amine.
| Compound Name | 2-methyl-N-(2-methylpropyl)-5-methylsulfonyl-2-propylpentan-1-amine |
|---|---|
| PubChem CID | 55161198 |
| Molecular Formula | C14H31NO2S |
| Molecular Weight | 277.47 g/mol |
| Exact Mass | 277.21 |
| IUPAC Name | 2-methyl-N-(2-methylpropyl)-5-methylsulfonyl-2-propylpentan-1-amine |
| SMILES | CCCC(C)(CCCS(C)(=O)=O)CNCC(C)C |
| InChI | InChI=1S/C14H31NO2S/c1-6-8-14(4,12-15-11-13(2)3)9-7-10-18(5,16)17/h13,15H,6-12H2,1-5H3 |
| InChIKey | IZWCKCDTMLRWMI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |