C16H29NS — CID 55237684
2-methyl-N-(2-methylpropyl)-2-(2-thiophen-2-ylethyl)pentan-1-amine (PubChem CID 55237684) has the molecular formula C16H29NS and a molecular weight of 267.48 g/mol. Its IUPAC name is 2-methyl-N-(2-methylpropyl)-2-(2-thiophen-2-ylethyl)pentan-1-amine.
| Compound Name | 2-methyl-N-(2-methylpropyl)-2-(2-thiophen-2-ylethyl)pentan-1-amine |
|---|---|
| PubChem CID | 55237684 |
| Molecular Formula | C16H29NS |
| Molecular Weight | 267.48 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 2-methyl-N-(2-methylpropyl)-2-(2-thiophen-2-ylethyl)pentan-1-amine |
| SMILES | CCCC(C)(CCc1cccs1)CNCC(C)C |
| InChI | InChI=1S/C16H29NS/c1-5-9-16(4,13-17-12-14(2)3)10-8-15-7-6-11-18-15/h6-7,11,14,17H,5,8-10,12-13H2,1-4H3 |
| InChIKey | PNQHHKJVNQREBV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |