C14H23NS — CID 102641460
2-methyl-N-(2-methylpropyl)-2-(thiophen-2-ylmethyl)but-3-en-1-amine (PubChem CID 102641460) has the molecular formula C14H23NS and a molecular weight of 237.41 g/mol. Its IUPAC name is 2-methyl-N-(2-methylpropyl)-2-(thiophen-2-ylmethyl)but-3-en-1-amine.
| Compound Name | 2-methyl-N-(2-methylpropyl)-2-(thiophen-2-ylmethyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 102641460 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 2-methyl-N-(2-methylpropyl)-2-(thiophen-2-ylmethyl)but-3-en-1-amine |
| SMILES | C=CC(C)(CNCC(C)C)Cc1cccs1 |
| InChI | InChI=1S/C14H23NS/c1-5-14(4,11-15-10-12(2)3)9-13-7-6-8-16-13/h5-8,12,15H,1,9-11H2,2-4H3 |
| InChIKey | ZEDHOCZTBYYGNA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|