C13H14BrNO2S — CID 55162656
2-bromo-6-methoxy-4-[(thiophen-3-ylmethylamino)methyl]phenol (PubChem CID 55162656) has the molecular formula C13H14BrNO2S and a molecular weight of 328.23 g/mol. Its IUPAC name is 2-bromo-6-methoxy-4-[(thiophen-3-ylmethylamino)methyl]phenol.
| Compound Name | 2-bromo-6-methoxy-4-[(thiophen-3-ylmethylamino)methyl]phenol |
|---|---|
| PubChem CID | 55162656 |
| Molecular Formula | C13H14BrNO2S |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 2-bromo-6-methoxy-4-[(thiophen-3-ylmethylamino)methyl]phenol |
| SMILES | COc1cc(CNCc2ccsc2)cc(Br)c1O |
| InChI | InChI=1S/C13H14BrNO2S/c1-17-12-5-10(4-11(14)13(12)16)7-15-6-9-2-3-18-8-9/h2-5,8,15-16H,6-7H2,1H3 |
| InChIKey | LJCHDDONQVGXHV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |