C11H22O2 — CID 551673
1,3-diethoxy-2-methylcyclohexane (PubChem CID 551673) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is 1,3-diethoxy-2-methylcyclohexane.
| Compound Name | 1,3-diethoxy-2-methylcyclohexane |
|---|---|
| PubChem CID | 551673 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 1,3-diethoxy-2-methylcyclohexane |
| SMILES | CCOC1CCCC(OCC)C1C |
| InChI | InChI=1S/C11H22O2/c1-4-12-10-7-6-8-11(9(10)3)13-5-2/h9-11H,4-8H2,1-3H3 |
| InChIKey | KZVBOBAOWYIZAW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |