C13H14ClN3O2 — CID 55168526
2-[(5-amino-2-chlorophenyl)methyl]-4,5-dimethyl-1H-pyridazine-3,6-dione (PubChem CID 55168526) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 2-[(5-amino-2-chlorophenyl)methyl]-4,5-dimethyl-1H-pyridazine-3,6-dione.
| Compound Name | 2-[(5-amino-2-chlorophenyl)methyl]-4,5-dimethyl-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 55168526 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-[(5-amino-2-chlorophenyl)methyl]-4,5-dimethyl-1H-pyridazine-3,6-dione |
| SMILES | Cc1c(C)c(=O)n(Cc2cc(N)ccc2Cl)[nH]c1=O |
| InChI | InChI=1S/C13H14ClN3O2/c1-7-8(2)13(19)17(16-12(7)18)6-9-5-10(15)3-4-11(9)14/h3-5H,6,15H2,1-2H3,(H,16,18) |
| InChIKey | JKVVPFCEPQUCRU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|