C12H9ClF2N2O — CID 55169086
5-chloro-6-[(2,5-difluorophenoxy)methyl]pyridin-2-amine (PubChem CID 55169086) has the molecular formula C12H9ClF2N2O and a molecular weight of 270.67 g/mol. Its IUPAC name is 5-chloro-6-[(2,5-difluorophenoxy)methyl]pyridin-2-amine.
| Compound Name | 5-chloro-6-[(2,5-difluorophenoxy)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 55169086 |
| Molecular Formula | C12H9ClF2N2O |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 5-chloro-6-[(2,5-difluorophenoxy)methyl]pyridin-2-amine |
| SMILES | Nc1ccc(Cl)c(COc2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C12H9ClF2N2O/c13-8-2-4-12(16)17-10(8)6-18-11-5-7(14)1-3-9(11)15/h1-5H,6H2,(H2,16,17) |
| InChIKey | RNSIXIMGNZUSOS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |