C14H15N3S — CID 55170409
5-amino-2-(1-thiophen-2-ylpropan-2-ylamino)benzonitrile (PubChem CID 55170409) has the molecular formula C14H15N3S and a molecular weight of 257.36 g/mol. Its IUPAC name is 5-amino-2-(1-thiophen-2-ylpropan-2-ylamino)benzonitrile.
| Compound Name | 5-amino-2-(1-thiophen-2-ylpropan-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 55170409 |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 5-amino-2-(1-thiophen-2-ylpropan-2-ylamino)benzonitrile |
| SMILES | CC(Cc1cccs1)Nc1ccc(N)cc1C#N |
| InChI | InChI=1S/C14H15N3S/c1-10(7-13-3-2-6-18-13)17-14-5-4-12(16)8-11(14)9-15/h2-6,8,10,17H,7,16H2,1H3 |
| InChIKey | FQPFOEWEQCGRDF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|