C14H15BrN2S2 — CID 82804851
3-bromo-4-(1-thiophen-2-ylpropan-2-ylamino)benzenecarbothioamide (PubChem CID 82804851) has the molecular formula C14H15BrN2S2 and a molecular weight of 355.33 g/mol. Its IUPAC name is 3-bromo-4-(1-thiophen-2-ylpropan-2-ylamino)benzenecarbothioamide.
| Compound Name | 3-bromo-4-(1-thiophen-2-ylpropan-2-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 82804851 |
| Molecular Formula | C14H15BrN2S2 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 3-bromo-4-(1-thiophen-2-ylpropan-2-ylamino)benzenecarbothioamide |
| SMILES | CC(Cc1cccs1)Nc1ccc(C(N)=S)cc1Br |
| InChI | InChI=1S/C14H15BrN2S2/c1-9(7-11-3-2-6-19-11)17-13-5-4-10(14(16)18)8-12(13)15/h2-6,8-9,17H,7H2,1H3,(H2,16,18) |
| InChIKey | WGTWOZIGZLTAGL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|