C15H18N2S2 — CID 63292576
4-methyl-2-(1-thiophen-2-ylpropan-2-ylamino)benzenecarbothioamide (PubChem CID 63292576) has the molecular formula C15H18N2S2 and a molecular weight of 290.46 g/mol. Its IUPAC name is 4-methyl-2-(1-thiophen-2-ylpropan-2-ylamino)benzenecarbothioamide.
| Compound Name | 4-methyl-2-(1-thiophen-2-ylpropan-2-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 63292576 |
| Molecular Formula | C15H18N2S2 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-methyl-2-(1-thiophen-2-ylpropan-2-ylamino)benzenecarbothioamide |
| SMILES | Cc1ccc(C(N)=S)c(NC(C)Cc2cccs2)c1 |
| InChI | InChI=1S/C15H18N2S2/c1-10-5-6-13(15(16)18)14(8-10)17-11(2)9-12-4-3-7-19-12/h3-8,11,17H,9H2,1-2H3,(H2,16,18) |
| InChIKey | FTAYSWWUHFHBMK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|