C15H17BrN2OS — CID 82804835
3-bromo-4-[4-(furan-2-yl)butan-2-ylamino]benzenecarbothioamide (PubChem CID 82804835) has the molecular formula C15H17BrN2OS and a molecular weight of 353.29 g/mol. Its IUPAC name is 3-bromo-4-[4-(furan-2-yl)butan-2-ylamino]benzenecarbothioamide.
| Compound Name | 3-bromo-4-[4-(furan-2-yl)butan-2-ylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 82804835 |
| Molecular Formula | C15H17BrN2OS |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 3-bromo-4-[4-(furan-2-yl)butan-2-ylamino]benzenecarbothioamide |
| SMILES | CC(CCc1ccco1)Nc1ccc(C(N)=S)cc1Br |
| InChI | InChI=1S/C15H17BrN2OS/c1-10(4-6-12-3-2-8-19-12)18-14-7-5-11(15(17)20)9-13(14)16/h2-3,5,7-10,18H,4,6H2,1H3,(H2,17,20) |
| InChIKey | KJTXGLUHMILZML-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|