C12H15N3O3 — CID 55170799
methyl 5-[[(1-methylimidazol-2-yl)methylamino]methyl]furan-2-carboxylate (PubChem CID 55170799) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is methyl 5-[[(1-methylimidazol-2-yl)methylamino]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(1-methylimidazol-2-yl)methylamino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 55170799 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | methyl 5-[[(1-methylimidazol-2-yl)methylamino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNCc2nccn2C)o1 |
| InChI | InChI=1S/C12H15N3O3/c1-15-6-5-14-11(15)8-13-7-9-3-4-10(18-9)12(16)17-2/h3-6,13H,7-8H2,1-2H3 |
| InChIKey | NXJJNFPEMWVGTQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |