C12H15F3N2O — CID 55171098
1-(piperidin-4-ylmethyl)-5-(trifluoromethyl)pyridin-2-one (PubChem CID 55171098) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 1-(piperidin-4-ylmethyl)-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-(piperidin-4-ylmethyl)-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 55171098 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1-(piperidin-4-ylmethyl)-5-(trifluoromethyl)pyridin-2-one |
| SMILES | O=c1ccc(C(F)(F)F)cn1CC1CCNCC1 |
| InChI | InChI=1S/C12H15F3N2O/c13-12(14,15)10-1-2-11(18)17(8-10)7-9-3-5-16-6-4-9/h1-2,8-9,16H,3-7H2 |
| InChIKey | DJCOBXQDOXRGQF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |