C13H19F3N2O — CID 55171484
1-[2-(3-methylbutylamino)ethyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 55171484) has the molecular formula C13H19F3N2O and a molecular weight of 276.30 g/mol. Its IUPAC name is 1-[2-(3-methylbutylamino)ethyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[2-(3-methylbutylamino)ethyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 55171484 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-[2-(3-methylbutylamino)ethyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CC(C)CCNCCn1cc(C(F)(F)F)ccc1=O |
| InChI | InChI=1S/C13H19F3N2O/c1-10(2)5-6-17-7-8-18-9-11(13(14,15)16)3-4-12(18)19/h3-4,9-10,17H,5-8H2,1-2H3 |
| InChIKey | MTDZHLLRAGAJDS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|