C13H25N3OS — CID 55172014
2-carbamothioyl-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]pentanamide (PubChem CID 55172014) has the molecular formula C13H25N3OS and a molecular weight of 271.43 g/mol. Its IUPAC name is 2-carbamothioyl-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]pentanamide.
| Compound Name | 2-carbamothioyl-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 55172014 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-carbamothioyl-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]pentanamide |
| SMILES | CCCC(C(=O)N(C)CC1CCN(C)C1)C(N)=S |
| InChI | InChI=1S/C13H25N3OS/c1-4-5-11(12(14)18)13(17)16(3)9-10-6-7-15(2)8-10/h10-11H,4-9H2,1-3H3,(H2,14,18) |
| InChIKey | GZGRVLQCBXNVJR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|