C8H17N3S — CID 63276177
1-methyl-1-[(1-methylpyrrolidin-3-yl)methyl]thiourea (PubChem CID 63276177) has the molecular formula C8H17N3S and a molecular weight of 187.31 g/mol. Its IUPAC name is 1-methyl-1-[(1-methylpyrrolidin-3-yl)methyl]thiourea.
| Compound Name | 1-methyl-1-[(1-methylpyrrolidin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 63276177 |
| Molecular Formula | C8H17N3S |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1-methyl-1-[(1-methylpyrrolidin-3-yl)methyl]thiourea |
| SMILES | CN1CCC(CN(C)C(N)=S)C1 |
| InChI | InChI=1S/C8H17N3S/c1-10-4-3-7(5-10)6-11(2)8(9)12/h7H,3-6H2,1-2H3,(H2,9,12) |
| InChIKey | PQNZVKZYYHMMMJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|