C11H17N5O2 — CID 55176870
4-amino-N-(4-carbamoylcyclohexyl)-1H-pyrazole-5-carboxamide (PubChem CID 55176870) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 4-amino-N-(4-carbamoylcyclohexyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-amino-N-(4-carbamoylcyclohexyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 55176870 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 4-amino-N-(4-carbamoylcyclohexyl)-1H-pyrazole-5-carboxamide |
| SMILES | NC(=O)C1CCC(NC(=O)c2[nH]ncc2N)CC1 |
| InChI | InChI=1S/C11H17N5O2/c12-8-5-14-16-9(8)11(18)15-7-3-1-6(2-4-7)10(13)17/h5-7H,1-4,12H2,(H2,13,17)(H,14,16)(H,15,18) |
| InChIKey | LGVAMACDIIRQRE-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |