C26H42N5O3P — CID 143263544
4-amino-N-[4-(oxan-4-ylamino)cyclohexyl]-1H-pyrazole-5-carboxamide;3-[(Z)-but-1-enyl]-5-phosphanylhepta-4,6-dien-2-one (PubChem CID 143263544) has the molecular formula C26H42N5O3P and a molecular weight of 503.63 g/mol. Its IUPAC name is 4-amino-N-[4-(oxan-4-ylamino)cyclohexyl]-1H-pyrazole-5-carboxamide;3-[(Z)-but-1-enyl]-5-phosphanylhepta-4,6-dien-2-one.
| Compound Name | 4-amino-N-[4-(oxan-4-ylamino)cyclohexyl]-1H-pyrazole-5-carboxamide;3-[(Z)-but-1-enyl]-5-phosphanylhepta-4,6-dien-2-one |
|---|---|
| PubChem CID | 143263544 |
| Molecular Formula | C26H42N5O3P |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | 4-amino-N-[4-(oxan-4-ylamino)cyclohexyl]-1H-pyrazole-5-carboxamide;3-[(Z)-but-1-enyl]-5-phosphanylhepta-4,6-dien-2-one |
| SMILES | C=CC(P)=CC(/C=C\CC)C(C)=O.Nc1cn[nH]c1C(=O)NC1CCC(NC2CCOCC2)CC1 |
| InChI | InChI=1S/C15H25N5O2.C11H17OP/c16-13-9-17-20-14(13)15(21)19-11-3-1-10(2-4-11)18-12-5-7-22-8-6-12;1-4-6-7-10(9(3)12)8-11(13)5-2/h9-12,18H,1-8,16H2,(H,17,20)(H,19,21);5-8,10H,2,4,13H2,1,3H3/b;7-6-,11-8? |
| InChIKey | JTVHUAULVHUSDW-WDWHHGGESA-N |
| XLogP | 3.90 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|