About (2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate
(2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate (PubChem CID 55179314) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is (2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | (2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate |
| PubChem CID | 55179314 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate |
| SMILES | CCC1(C(=O)OC2CCCCC2C)CCNCC1 |
| InChI | InChI=1S/C15H27NO2/c1-3-15(8-10-16-11-9-15)14(17)18-13-7-5-4-6-12(13)2/h12-13,16H,3-11H2,1-2H3 |
| InChIKey | DHKFYUOPNZPELP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate?
The IUPAC name of (2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate (CID 55179314) is (2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate.
What is the SMILES notation for (2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate?
The canonical SMILES for (2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate is CCC1(C(=O)OC2CCCCC2C)CCNCC1.
What is the InChIKey of (2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate?
The InChIKey is DHKFYUOPNZPELP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2/c1-3-15(8-10-16-11-9-15)14(17)18-13-7-5-4-6-12(13)2/h12-13,16H,3-11H2,1-2H3.
What are the key properties of (2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate?
(2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate has a molecular weight of 253.39 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclohexyl) 4-ethylpiperidine-4-carboxylate is sourced from PubChem (CID 55179314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).