About (2-methylcyclohexyl) piperidine-4-carboxylate
(2-methylcyclohexyl) piperidine-4-carboxylate (PubChem CID 61277227) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is (2-methylcyclohexyl) piperidine-4-carboxylate.
Molecular Properties
| Compound Name | (2-methylcyclohexyl) piperidine-4-carboxylate |
| PubChem CID | 61277227 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (2-methylcyclohexyl) piperidine-4-carboxylate |
| SMILES | CC1CCCCC1OC(=O)C1CCNCC1 |
| InChI | InChI=1S/C13H23NO2/c1-10-4-2-3-5-12(10)16-13(15)11-6-8-14-9-7-11/h10-12,14H,2-9H2,1H3 |
| InChIKey | AHZCBMROQPFSMA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methylcyclohexyl) piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclohexyl) piperidine-4-carboxylate?
The IUPAC name of (2-methylcyclohexyl) piperidine-4-carboxylate (CID 61277227) is (2-methylcyclohexyl) piperidine-4-carboxylate.
What is the SMILES notation for (2-methylcyclohexyl) piperidine-4-carboxylate?
The canonical SMILES for (2-methylcyclohexyl) piperidine-4-carboxylate is CC1CCCCC1OC(=O)C1CCNCC1.
What is the InChIKey of (2-methylcyclohexyl) piperidine-4-carboxylate?
The InChIKey is AHZCBMROQPFSMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-10-4-2-3-5-12(10)16-13(15)11-6-8-14-9-7-11/h10-12,14H,2-9H2,1H3.
What are the key properties of (2-methylcyclohexyl) piperidine-4-carboxylate?
(2-methylcyclohexyl) piperidine-4-carboxylate has a molecular weight of 225.33 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclohexyl) piperidine-4-carboxylate is sourced from PubChem (CID 61277227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).