C13H11Br3O2 — CID 55180164
1-[5-(2,4,6-tribromophenyl)furan-2-yl]propan-2-ol (PubChem CID 55180164) has the molecular formula C13H11Br3O2 and a molecular weight of 438.94 g/mol. Its IUPAC name is 1-[5-(2,4,6-tribromophenyl)furan-2-yl]propan-2-ol.
| Compound Name | 1-[5-(2,4,6-tribromophenyl)furan-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 55180164 |
| Molecular Formula | C13H11Br3O2 |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 435.83 |
| IUPAC Name | 1-[5-(2,4,6-tribromophenyl)furan-2-yl]propan-2-ol |
| SMILES | CC(O)Cc1ccc(-c2c(Br)cc(Br)cc2Br)o1 |
| InChI | InChI=1S/C13H11Br3O2/c1-7(17)4-9-2-3-12(18-9)13-10(15)5-8(14)6-11(13)16/h2-3,5-7,17H,4H2,1H3 |
| InChIKey | NWAVDLNXNWUQAZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |