C13H7ClF2N2S — CID 55180242
4-(4-amino-2,6-difluorophenyl)sulfanyl-3-chlorobenzonitrile (PubChem CID 55180242) has the molecular formula C13H7ClF2N2S and a molecular weight of 296.73 g/mol. Its IUPAC name is 4-(4-amino-2,6-difluorophenyl)sulfanyl-3-chlorobenzonitrile.
| Compound Name | 4-(4-amino-2,6-difluorophenyl)sulfanyl-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 55180242 |
| Molecular Formula | C13H7ClF2N2S |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 4-(4-amino-2,6-difluorophenyl)sulfanyl-3-chlorobenzonitrile |
| SMILES | N#Cc1ccc(Sc2c(F)cc(N)cc2F)c(Cl)c1 |
| InChI | InChI=1S/C13H7ClF2N2S/c14-9-3-7(6-17)1-2-12(9)19-13-10(15)4-8(18)5-11(13)16/h1-5H,18H2 |
| InChIKey | LDDSSPHDMMUINY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|