C13H20ClN3O — CID 55180596
2-[2-(aminomethyl)-5-chloro-N-methylanilino]-N-propylacetamide (PubChem CID 55180596) has the molecular formula C13H20ClN3O and a molecular weight of 269.78 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-5-chloro-N-methylanilino]-N-propylacetamide.
| Compound Name | 2-[2-(aminomethyl)-5-chloro-N-methylanilino]-N-propylacetamide |
|---|---|
| PubChem CID | 55180596 |
| Molecular Formula | C13H20ClN3O |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[2-(aminomethyl)-5-chloro-N-methylanilino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)c1cc(Cl)ccc1CN |
| InChI | InChI=1S/C13H20ClN3O/c1-3-6-16-13(18)9-17(2)12-7-11(14)5-4-10(12)8-15/h4-5,7H,3,6,8-9,15H2,1-2H3,(H,16,18) |
| InChIKey | FHOMGPPJXCAIIG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |