C13H19F3N4O — CID 79873585
2-[[3-(aminomethyl)-6-(trifluoromethyl)-2-pyridinyl]-methylamino]-N-propylacetamide (PubChem CID 79873585) has the molecular formula C13H19F3N4O and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-[[3-(aminomethyl)-6-(trifluoromethyl)-2-pyridinyl]-methylamino]-N-propylacetamide.
| Compound Name | 2-[[3-(aminomethyl)-6-(trifluoromethyl)-2-pyridinyl]-methylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 79873585 |
| Molecular Formula | C13H19F3N4O |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-[[3-(aminomethyl)-6-(trifluoromethyl)-2-pyridinyl]-methylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)c1nc(C(F)(F)F)ccc1CN |
| InChI | InChI=1S/C13H19F3N4O/c1-3-6-18-11(21)8-20(2)12-9(7-17)4-5-10(19-12)13(14,15)16/h4-5H,3,6-8,17H2,1-2H3,(H,18,21) |
| InChIKey | KGVLHERMHXFLJA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |