C14H17N3O — CID 55181154
3-(1-phenylcyclopropyl)-N-propan-2-yl-1,2,4-oxadiazol-5-amine (PubChem CID 55181154) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-(1-phenylcyclopropyl)-N-propan-2-yl-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(1-phenylcyclopropyl)-N-propan-2-yl-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 55181154 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-(1-phenylcyclopropyl)-N-propan-2-yl-1,2,4-oxadiazol-5-amine |
| SMILES | CC(C)Nc1nc(C2(c3ccccc3)CC2)no1 |
| InChI | InChI=1S/C14H17N3O/c1-10(2)15-13-16-12(17-18-13)14(8-9-14)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H,15,16,17) |
| InChIKey | JMIZUFTXSQLXHD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |