C13H18ClN3OS — CID 55181567
2-(2-carbamothioyl-5-chloro-N-ethylanilino)-N,N-dimethylacetamide (PubChem CID 55181567) has the molecular formula C13H18ClN3OS and a molecular weight of 299.83 g/mol. Its IUPAC name is 2-(2-carbamothioyl-5-chloro-N-ethylanilino)-N,N-dimethylacetamide.
| Compound Name | 2-(2-carbamothioyl-5-chloro-N-ethylanilino)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 55181567 |
| Molecular Formula | C13H18ClN3OS |
| Molecular Weight | 299.83 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-(2-carbamothioyl-5-chloro-N-ethylanilino)-N,N-dimethylacetamide |
| SMILES | CCN(CC(=O)N(C)C)c1cc(Cl)ccc1C(N)=S |
| InChI | InChI=1S/C13H18ClN3OS/c1-4-17(8-12(18)16(2)3)11-7-9(14)5-6-10(11)13(15)19/h5-7H,4,8H2,1-3H3,(H2,15,19) |
| InChIKey | CMEYTJNNSRCEBK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.83 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|