C15H23N3O2S — CID 81298153
2-(2-carbamothioyl-5-methoxy-N-propylanilino)-N,N-dimethylacetamide (PubChem CID 81298153) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 2-(2-carbamothioyl-5-methoxy-N-propylanilino)-N,N-dimethylacetamide.
| Compound Name | 2-(2-carbamothioyl-5-methoxy-N-propylanilino)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 81298153 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-(2-carbamothioyl-5-methoxy-N-propylanilino)-N,N-dimethylacetamide |
| SMILES | CCCN(CC(=O)N(C)C)c1cc(OC)ccc1C(N)=S |
| InChI | InChI=1S/C15H23N3O2S/c1-5-8-18(10-14(19)17(2)3)13-9-11(20-4)6-7-12(13)15(16)21/h6-7,9H,5,8,10H2,1-4H3,(H2,16,21) |
| InChIKey | GPFCEDPBSOFHAY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|