C14H20FNO2 — CID 55184646
(1R)-1-[2-(2,6-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanol (PubChem CID 55184646) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is (1R)-1-[2-(2,6-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanol.
| Compound Name | (1R)-1-[2-(2,6-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 55184646 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (1R)-1-[2-(2,6-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanol |
| SMILES | CC1CN(c2cccc(F)c2[C@@H](C)O)CC(C)O1 |
| InChI | InChI=1S/C14H20FNO2/c1-9-7-16(8-10(2)18-9)13-6-4-5-12(15)14(13)11(3)17/h4-6,9-11,17H,7-8H2,1-3H3/t9?,10?,11-/m1/s1 |
| InChIKey | JNLVDHXJANHKDM-VQXHTEKXSA-N |
| XLogP | 2.49 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |