C15H22FNO — CID 104874438
(1S)-1-[2-(3,4-dimethylpiperidin-1-yl)-6-fluorophenyl]ethanol (PubChem CID 104874438) has the molecular formula C15H22FNO and a molecular weight of 251.34 g/mol. Its IUPAC name is (1S)-1-[2-(3,4-dimethylpiperidin-1-yl)-6-fluorophenyl]ethanol.
| Compound Name | (1S)-1-[2-(3,4-dimethylpiperidin-1-yl)-6-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 104874438 |
| Molecular Formula | C15H22FNO |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (1S)-1-[2-(3,4-dimethylpiperidin-1-yl)-6-fluorophenyl]ethanol |
| SMILES | CC1CCN(c2cccc(F)c2[C@H](C)O)CC1C |
| InChI | InChI=1S/C15H22FNO/c1-10-7-8-17(9-11(10)2)14-6-4-5-13(16)15(14)12(3)18/h4-6,10-12,18H,7-9H2,1-3H3/t10?,11?,12-/m0/s1 |
| InChIKey | KMEICZYTWIMSNU-MCIGGMRASA-N |
| XLogP | 3.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |