C17H24FNO — CID 78939853
(1S)-1-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-6-fluorophenyl]ethanol (PubChem CID 78939853) has the molecular formula C17H24FNO and a molecular weight of 277.38 g/mol. Its IUPAC name is (1S)-1-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-6-fluorophenyl]ethanol.
| Compound Name | (1S)-1-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-6-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 78939853 |
| Molecular Formula | C17H24FNO |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (1S)-1-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-6-fluorophenyl]ethanol |
| SMILES | C[C@H](O)c1c(F)cccc1N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C17H24FNO/c1-12(20)17-15(18)7-4-8-16(17)19-10-9-13-5-2-3-6-14(13)11-19/h4,7-8,12-14,20H,2-3,5-6,9-11H2,1H3/t12-,13?,14?/m0/s1 |
| InChIKey | PXQBZOAIGWIJJW-HSBZDZAISA-N |
| XLogP | 3.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |