C13H16Cl3NO — CID 55185882
3,4-dichloro-N-(3-chloropropyl)-N-propan-2-ylbenzamide (PubChem CID 55185882) has the molecular formula C13H16Cl3NO and a molecular weight of 308.64 g/mol. Its IUPAC name is 3,4-dichloro-N-(3-chloropropyl)-N-propan-2-ylbenzamide.
| Compound Name | 3,4-dichloro-N-(3-chloropropyl)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 55185882 |
| Molecular Formula | C13H16Cl3NO |
| Molecular Weight | 308.64 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 3,4-dichloro-N-(3-chloropropyl)-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(CCCCl)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl3NO/c1-9(2)17(7-3-6-14)13(18)10-4-5-11(15)12(16)8-10/h4-5,8-9H,3,6-7H2,1-2H3 |
| InChIKey | DYSXJVAJVQZCPW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|