C14H18INO — CID 55185952
N-[1-(7-iodo-3-methyl-1-benzofuran-2-yl)ethyl]propan-1-amine (PubChem CID 55185952) has the molecular formula C14H18INO and a molecular weight of 343.21 g/mol. Its IUPAC name is N-[1-(7-iodo-3-methyl-1-benzofuran-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(7-iodo-3-methyl-1-benzofuran-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 55185952 |
| Molecular Formula | C14H18INO |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | N-[1-(7-iodo-3-methyl-1-benzofuran-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1oc2c(I)cccc2c1C |
| InChI | InChI=1S/C14H18INO/c1-4-8-16-10(3)13-9(2)11-6-5-7-12(15)14(11)17-13/h5-7,10,16H,4,8H2,1-3H3 |
| InChIKey | IYQAAFIPKNLCGB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|