C13H22N4 — CID 55188732
6-cyclopropyl-2-N,2-N,4-N-triethylpyrimidine-2,4-diamine (PubChem CID 55188732) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 6-cyclopropyl-2-N,2-N,4-N-triethylpyrimidine-2,4-diamine.
| Compound Name | 6-cyclopropyl-2-N,2-N,4-N-triethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 55188732 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 6-cyclopropyl-2-N,2-N,4-N-triethylpyrimidine-2,4-diamine |
| SMILES | CCNc1cc(C2CC2)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C13H22N4/c1-4-14-12-9-11(10-7-8-10)15-13(16-12)17(5-2)6-3/h9-10H,4-8H2,1-3H3,(H,14,15,16) |
| InChIKey | OXFMLDJJIAUHMH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |