C15H23BrFN — CID 55191844
N-[(3-bromo-4-fluorophenyl)methyl]-N-propan-2-ylpentan-1-amine (PubChem CID 55191844) has the molecular formula C15H23BrFN and a molecular weight of 316.26 g/mol. Its IUPAC name is N-[(3-bromo-4-fluorophenyl)methyl]-N-propan-2-ylpentan-1-amine.
| Compound Name | N-[(3-bromo-4-fluorophenyl)methyl]-N-propan-2-ylpentan-1-amine |
|---|---|
| PubChem CID | 55191844 |
| Molecular Formula | C15H23BrFN |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-[(3-bromo-4-fluorophenyl)methyl]-N-propan-2-ylpentan-1-amine |
| SMILES | CCCCCN(Cc1ccc(F)c(Br)c1)C(C)C |
| InChI | InChI=1S/C15H23BrFN/c1-4-5-6-9-18(12(2)3)11-13-7-8-15(17)14(16)10-13/h7-8,10,12H,4-6,9,11H2,1-3H3 |
| InChIKey | QRJKAESZIZLZTN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|