C14H22ClN — CID 90144753
N-[(3-chlorophenyl)methyl]-N-propan-2-ylbutan-1-amine (PubChem CID 90144753) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-N-propan-2-ylbutan-1-amine.
| Compound Name | N-[(3-chlorophenyl)methyl]-N-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 90144753 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-N-propan-2-ylbutan-1-amine |
| SMILES | CCCCN(Cc1cccc(Cl)c1)C(C)C |
| InChI | InChI=1S/C14H22ClN/c1-4-5-9-16(12(2)3)11-13-7-6-8-14(15)10-13/h6-8,10,12H,4-5,9,11H2,1-3H3 |
| InChIKey | TYORXAOAZVXVBQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |