C13H19BrClN — CID 80680513
3-bromo-N-[(3-chlorophenyl)methyl]-N-propan-2-ylpropan-1-amine (PubChem CID 80680513) has the molecular formula C13H19BrClN and a molecular weight of 304.66 g/mol. Its IUPAC name is 3-bromo-N-[(3-chlorophenyl)methyl]-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-bromo-N-[(3-chlorophenyl)methyl]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 80680513 |
| Molecular Formula | C13H19BrClN |
| Molecular Weight | 304.66 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 3-bromo-N-[(3-chlorophenyl)methyl]-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)N(CCCBr)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H19BrClN/c1-11(2)16(8-4-7-14)10-12-5-3-6-13(15)9-12/h3,5-6,9,11H,4,7-8,10H2,1-2H3 |
| InChIKey | DNDQPOZALVZJJZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.66 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|