C13H18BrF2N — CID 80680405
3-bromo-N-[(2,5-difluorophenyl)methyl]-N-propan-2-ylpropan-1-amine (PubChem CID 80680405) has the molecular formula C13H18BrF2N and a molecular weight of 306.19 g/mol. Its IUPAC name is 3-bromo-N-[(2,5-difluorophenyl)methyl]-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-bromo-N-[(2,5-difluorophenyl)methyl]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 80680405 |
| Molecular Formula | C13H18BrF2N |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 3-bromo-N-[(2,5-difluorophenyl)methyl]-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)N(CCCBr)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C13H18BrF2N/c1-10(2)17(7-3-6-14)9-11-8-12(15)4-5-13(11)16/h4-5,8,10H,3,6-7,9H2,1-2H3 |
| InChIKey | BCJFOOPYTSKBGW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|