C14H19Cl2NS — CID 55194771
N-[2-(2,5-dichlorophenyl)sulfanylpropyl]cyclopentanamine (PubChem CID 55194771) has the molecular formula C14H19Cl2NS and a molecular weight of 304.29 g/mol. Its IUPAC name is N-[2-(2,5-dichlorophenyl)sulfanylpropyl]cyclopentanamine.
| Compound Name | N-[2-(2,5-dichlorophenyl)sulfanylpropyl]cyclopentanamine |
|---|---|
| PubChem CID | 55194771 |
| Molecular Formula | C14H19Cl2NS |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-[2-(2,5-dichlorophenyl)sulfanylpropyl]cyclopentanamine |
| SMILES | CC(CNC1CCCC1)Sc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H19Cl2NS/c1-10(9-17-12-4-2-3-5-12)18-14-8-11(15)6-7-13(14)16/h6-8,10,12,17H,2-5,9H2,1H3 |
| InChIKey | IBDPSIAFZYFSPK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |